C33H39NO4 — CID 69130640
[4-[4-[3-(cyclopropylamino)propoxy]-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]phenyl] hydrogen carbonate (PubChem CID 69130640) has the molecular formula C33H39NO4 and a molecular weight of 513.68 g/mol. Its IUPAC name is [4-[4-[3-(cyclopropylamino)propoxy]-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]phenyl] hydrogen carbonate.
| Compound Name | [4-[4-[3-(cyclopropylamino)propoxy]-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]phenyl] hydrogen carbonate |
|---|---|
| PubChem CID | 69130640 |
| Molecular Formula | C33H39NO4 |
| Molecular Weight | 513.68 g/mol |
| Exact Mass | 513.29 |
| IUPAC Name | [4-[4-[3-(cyclopropylamino)propoxy]-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]phenyl] hydrogen carbonate |
| SMILES | CC1(C)CCC(C)(C)c2cc(-c3cc(-c4ccc(OC(=O)O)cc4)ccc3OCCCNC3CC3)ccc21 |
| InChI | InChI=1S/C33H39NO4/c1-32(2)16-17-33(3,4)29-21-24(8-14-28(29)32)27-20-23(22-6-12-26(13-7-22)38-31(35)36)9-15-30(27)37-19-5-18-34-25-10-11-25/h6-9,12-15,20-21,25,34H,5,10-11,16-19H2,1-4H3,(H,35,36) |
| InChIKey | UICWEVFMKPYKON-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.68 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|