About 4-[(1,2-dimethylindol-3-yl)-phenylmethylidene]cyclohexa-2,5-dien-1-imine
4-[(1,2-dimethylindol-3-yl)-phenylmethylidene]cyclohexa-2,5-dien-1-imine (PubChem CID 69131100) has the molecular formula C23H20N2
and a molecular weight of 324.43 g/mol. Its IUPAC name is 4-[(1,2-dimethylindol-3-yl)-phenylmethylidene]cyclohexa-2,5-dien-1-imine.
Molecular Properties
| Compound Name | 4-[(1,2-dimethylindol-3-yl)-phenylmethylidene]cyclohexa-2,5-dien-1-imine |
| PubChem CID | 69131100 |
| Molecular Formula | C23H20N2 |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 4-[(1,2-dimethylindol-3-yl)-phenylmethylidene]cyclohexa-2,5-dien-1-imine |
| SMILES | [H]N=C1C=CC(=C(c2ccccc2)c2c(C)n(C)c3ccccc23)C=C1 |
| InChI | InChI=1S/C23H20N2/c1-16-22(20-10-6-7-11-21(20)25(16)2)23(17-8-4-3-5-9-17)18-12-14-19(24)15-13-18/h3-15,24H,1-2H3/b23-18-,24-19+ |
| InChIKey | ICUQSBJJVOAUIL-XPKROWLPSA-N |
| XLogP | 5.43 |
| TPSA | 28.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[(1,2-dimethylindol-3-yl)-phenylmethylidene]cyclohexa-2,5-dien-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1,2-dimethylindol-3-yl)-phenylmethylidene]cyclohexa-2,5-dien-1-imine?
The IUPAC name of 4-[(1,2-dimethylindol-3-yl)-phenylmethylidene]cyclohexa-2,5-dien-1-imine (CID 69131100) is 4-[(1,2-dimethylindol-3-yl)-phenylmethylidene]cyclohexa-2,5-dien-1-imine.
What is the SMILES notation for 4-[(1,2-dimethylindol-3-yl)-phenylmethylidene]cyclohexa-2,5-dien-1-imine?
The canonical SMILES for 4-[(1,2-dimethylindol-3-yl)-phenylmethylidene]cyclohexa-2,5-dien-1-imine is [H]N=C1C=CC(=C(c2ccccc2)c2c(C)n(C)c3ccccc23)C=C1.
What is the InChIKey of 4-[(1,2-dimethylindol-3-yl)-phenylmethylidene]cyclohexa-2,5-dien-1-imine?
The InChIKey is ICUQSBJJVOAUIL-XPKROWLPSA-N. The full InChI is InChI=1S/C23H20N2/c1-16-22(20-10-6-7-11-21(20)25(16)2)23(17-8-4-3-5-9-17)18-12-14-19(24)15-13-18/h3-15,24H,1-2H3/b23-18-,24-19+.
What are the key properties of 4-[(1,2-dimethylindol-3-yl)-phenylmethylidene]cyclohexa-2,5-dien-1-imine?
4-[(1,2-dimethylindol-3-yl)-phenylmethylidene]cyclohexa-2,5-dien-1-imine has a molecular weight of 324.43 g/mol, XLogP of 5.43, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1,2-dimethylindol-3-yl)-phenylmethylidene]cyclohexa-2,5-dien-1-imine is sourced from PubChem (CID 69131100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).