C28H41N5O6Si — CID 69131107
N-[2-[ethyl-[2-(propan-2-ylamino)ethyl]amino]-4,6-dimethoxypyrimidin-5-yl]-5-(2-methyl-5-trimethylsilylphenoxy)-3-oxofuran-2-carboxamide (PubChem CID 69131107) has the molecular formula C28H41N5O6Si and a molecular weight of 571.75 g/mol. Its IUPAC name is N-[2-[ethyl-[2-(propan-2-ylamino)ethyl]amino]-4,6-dimethoxypyrimidin-5-yl]-5-(2-methyl-5-trimethylsilylphenoxy)-3-oxofuran-2-carboxamide.
| Compound Name | N-[2-[ethyl-[2-(propan-2-ylamino)ethyl]amino]-4,6-dimethoxypyrimidin-5-yl]-5-(2-methyl-5-trimethylsilylphenoxy)-3-oxofuran-2-carboxamide |
|---|---|
| PubChem CID | 69131107 |
| Molecular Formula | C28H41N5O6Si |
| Molecular Weight | 571.75 g/mol |
| Exact Mass | 571.28 |
| IUPAC Name | N-[2-[ethyl-[2-(propan-2-ylamino)ethyl]amino]-4,6-dimethoxypyrimidin-5-yl]-5-(2-methyl-5-trimethylsilylphenoxy)-3-oxofuran-2-carboxamide |
| SMILES | CCN(CCNC(C)C)c1nc(OC)c(NC(=O)C2OC(Oc3cc([Si](C)(C)C)ccc3C)=CC2=O)c(OC)n1 |
| InChI | InChI=1S/C28H41N5O6Si/c1-10-33(14-13-29-17(2)3)28-31-26(36-5)23(27(32-28)37-6)30-25(35)24-20(34)16-22(39-24)38-21-15-19(40(7,8)9)12-11-18(21)4/h11-12,15-17,24,29H,10,13-14H2,1-9H3,(H,30,35) |
| InChIKey | XNPBCIYYVIIPCL-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 124.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.75 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|