About 3-(thiolan-2-yl)oxolane
3-(thiolan-2-yl)oxolane (PubChem CID 69131875) has the molecular formula C8H14OS
and a molecular weight of 158.27 g/mol. Its IUPAC name is 3-(thiolan-2-yl)oxolane.
Molecular Properties
| Compound Name | 3-(thiolan-2-yl)oxolane |
| PubChem CID | 69131875 |
| Molecular Formula | C8H14OS |
| Molecular Weight | 158.27 g/mol |
| Exact Mass | 158.08 |
| IUPAC Name | 3-(thiolan-2-yl)oxolane |
| SMILES | C1CSC(C2CCOC2)C1 |
| InChI | InChI=1S/C8H14OS/c1-2-8(10-5-1)7-3-4-9-6-7/h7-8H,1-6H2 |
| InChIKey | CXOINSDROZAWGN-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.27 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(thiolan-2-yl)oxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(thiolan-2-yl)oxolane?
The IUPAC name of 3-(thiolan-2-yl)oxolane (CID 69131875) is 3-(thiolan-2-yl)oxolane.
What is the SMILES notation for 3-(thiolan-2-yl)oxolane?
The canonical SMILES for 3-(thiolan-2-yl)oxolane is C1CSC(C2CCOC2)C1.
What is the InChIKey of 3-(thiolan-2-yl)oxolane?
The InChIKey is CXOINSDROZAWGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14OS/c1-2-8(10-5-1)7-3-4-9-6-7/h7-8H,1-6H2.
What are the key properties of 3-(thiolan-2-yl)oxolane?
3-(thiolan-2-yl)oxolane has a molecular weight of 158.27 g/mol, XLogP of 1.92, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(thiolan-2-yl)oxolane is sourced from PubChem (CID 69131875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).