C13H10 — CID 6913203
1,2,3,4,5,6,7,8,9,9-decadeuteriofluorene (PubChem CID 6913203) has the molecular formula C13H10 and a molecular weight of 176.28 g/mol. Its IUPAC name is 1,2,3,4,5,6,7,8,9,9-decadeuteriofluorene.
| Compound Name | 1,2,3,4,5,6,7,8,9,9-decadeuteriofluorene |
|---|---|
| PubChem CID | 6913203 |
| Molecular Formula | C13H10 |
| Molecular Weight | 176.28 g/mol |
| Exact Mass | 176.14 |
| IUPAC Name | 1,2,3,4,5,6,7,8,9,9-decadeuteriofluorene |
| SMILES | [2H]c1c([2H])c([2H])c2c(c1[2H])-c1c([2H])c([2H])c([2H])c([2H])c1C2([2H])[2H] |
| InChI | InChI=1S/C13H10/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12/h1-8H,9H2/i1D,2D,3D,4D,5D,6D,7D,8D,9D2 |
| InChIKey | NIHNNTQXNPWCJQ-QNNBDYQESA-N |
| XLogP | 3.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.28 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |