C34H37N3O4 — CID 69132098
4-[3-[2-[2-(2-cyanoethenyl)phenoxy]phenyl]propanoyl]-3-(2,2-dimethyl-1-phenylpropyl)piperazine-1-carboxylic acid (PubChem CID 69132098) has the molecular formula C34H37N3O4 and a molecular weight of 551.69 g/mol. Its IUPAC name is 4-[3-[2-[2-(2-cyanoethenyl)phenoxy]phenyl]propanoyl]-3-(2,2-dimethyl-1-phenylpropyl)piperazine-1-carboxylic acid.
| Compound Name | 4-[3-[2-[2-(2-cyanoethenyl)phenoxy]phenyl]propanoyl]-3-(2,2-dimethyl-1-phenylpropyl)piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 69132098 |
| Molecular Formula | C34H37N3O4 |
| Molecular Weight | 551.69 g/mol |
| Exact Mass | 551.28 |
| IUPAC Name | 4-[3-[2-[2-(2-cyanoethenyl)phenoxy]phenyl]propanoyl]-3-(2,2-dimethyl-1-phenylpropyl)piperazine-1-carboxylic acid |
| SMILES | CC(C)(C)C(c1ccccc1)C1CN(C(=O)O)CCN1C(=O)CCc1ccccc1Oc1ccccc1C=CC#N |
| InChI | InChI=1S/C34H37N3O4/c1-34(2,3)32(27-14-5-4-6-15-27)28-24-36(33(39)40)22-23-37(28)31(38)20-19-26-13-8-10-18-30(26)41-29-17-9-7-12-25(29)16-11-21-35/h4-18,28,32H,19-20,22-24H2,1-3H3,(H,39,40) |
| InChIKey | UPEPVURHHMYQGA-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 93.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.69 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|