About [3-amino-6-(4-amino-3-hydroxypiperidin-1-yl)-4-propylthieno[2,3-b]pyridin-2-yl] carbamate
[3-amino-6-(4-amino-3-hydroxypiperidin-1-yl)-4-propylthieno[2,3-b]pyridin-2-yl] carbamate (PubChem CID 69132162) has the molecular formula C16H23N5O3S
and a molecular weight of 365.46 g/mol. Its IUPAC name is [3-amino-6-(4-amino-3-hydroxypiperidin-1-yl)-4-propylthieno[2,3-b]pyridin-2-yl] carbamate.
Molecular Properties
| Compound Name | [3-amino-6-(4-amino-3-hydroxypiperidin-1-yl)-4-propylthieno[2,3-b]pyridin-2-yl] carbamate |
| PubChem CID | 69132162 |
| Molecular Formula | C16H23N5O3S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | [3-amino-6-(4-amino-3-hydroxypiperidin-1-yl)-4-propylthieno[2,3-b]pyridin-2-yl] carbamate |
| SMILES | CCCc1cc(N2CCC(N)C(O)C2)nc2sc(OC(N)=O)c(N)c12 |
| InChI | InChI=1S/C16H23N5O3S/c1-2-3-8-6-11(21-5-4-9(17)10(22)7-21)20-14-12(8)13(18)15(25-14)24-16(19)23/h6,9-10,22H,2-5,7,17-18H2,1H3,(H2,19,23) |
| InChIKey | MZVFPZGXQCDFIF-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 140.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze [3-amino-6-(4-amino-3-hydroxypiperidin-1-yl)-4-propylthieno[2,3-b]pyridin-2-yl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-amino-6-(4-amino-3-hydroxypiperidin-1-yl)-4-propylthieno[2,3-b]pyridin-2-yl] carbamate?
The IUPAC name of [3-amino-6-(4-amino-3-hydroxypiperidin-1-yl)-4-propylthieno[2,3-b]pyridin-2-yl] carbamate (CID 69132162) is [3-amino-6-(4-amino-3-hydroxypiperidin-1-yl)-4-propylthieno[2,3-b]pyridin-2-yl] carbamate.
What is the SMILES notation for [3-amino-6-(4-amino-3-hydroxypiperidin-1-yl)-4-propylthieno[2,3-b]pyridin-2-yl] carbamate?
The canonical SMILES for [3-amino-6-(4-amino-3-hydroxypiperidin-1-yl)-4-propylthieno[2,3-b]pyridin-2-yl] carbamate is CCCc1cc(N2CCC(N)C(O)C2)nc2sc(OC(N)=O)c(N)c12.
What is the InChIKey of [3-amino-6-(4-amino-3-hydroxypiperidin-1-yl)-4-propylthieno[2,3-b]pyridin-2-yl] carbamate?
The InChIKey is MZVFPZGXQCDFIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23N5O3S/c1-2-3-8-6-11(21-5-4-9(17)10(22)7-21)20-14-12(8)13(18)15(25-14)24-16(19)23/h6,9-10,22H,2-5,7,17-18H2,1H3,(H2,19,23).
What are the key properties of [3-amino-6-(4-amino-3-hydroxypiperidin-1-yl)-4-propylthieno[2,3-b]pyridin-2-yl] carbamate?
[3-amino-6-(4-amino-3-hydroxypiperidin-1-yl)-4-propylthieno[2,3-b]pyridin-2-yl] carbamate has a molecular weight of 365.46 g/mol, XLogP of 1.19, 4 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [3-amino-6-(4-amino-3-hydroxypiperidin-1-yl)-4-propylthieno[2,3-b]pyridin-2-yl] carbamate is sourced from PubChem (CID 69132162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).