C25H31N3O2 — CID 69132473
2-[4-[1-[[6-(3-methoxyphenyl)-3-pyridinyl]methyl]piperidin-4-yl]butyl]-1,3-oxazole (PubChem CID 69132473) has the molecular formula C25H31N3O2 and a molecular weight of 405.54 g/mol. Its IUPAC name is 2-[4-[1-[[6-(3-methoxyphenyl)-3-pyridinyl]methyl]piperidin-4-yl]butyl]-1,3-oxazole.
| Compound Name | 2-[4-[1-[[6-(3-methoxyphenyl)-3-pyridinyl]methyl]piperidin-4-yl]butyl]-1,3-oxazole |
|---|---|
| PubChem CID | 69132473 |
| Molecular Formula | C25H31N3O2 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | 2-[4-[1-[[6-(3-methoxyphenyl)-3-pyridinyl]methyl]piperidin-4-yl]butyl]-1,3-oxazole |
| SMILES | COc1cccc(-c2ccc(CN3CCC(CCCCc4ncco4)CC3)cn2)c1 |
| InChI | InChI=1S/C25H31N3O2/c1-29-23-7-4-6-22(17-23)24-10-9-21(18-27-24)19-28-14-11-20(12-15-28)5-2-3-8-25-26-13-16-30-25/h4,6-7,9-10,13,16-18,20H,2-3,5,8,11-12,14-15,19H2,1H3 |
| InChIKey | DOMZWVRMXDTVJX-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 51.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|