About 2-(1H-imidazol-5-yl)-1,3-thiazole-5-sulfonamide
2-(1H-imidazol-5-yl)-1,3-thiazole-5-sulfonamide (PubChem CID 69132480) has the molecular formula C6H6N4O2S2
and a molecular weight of 230.27 g/mol. Its IUPAC name is 2-(1H-imidazol-5-yl)-1,3-thiazole-5-sulfonamide.
Molecular Properties
| Compound Name | 2-(1H-imidazol-5-yl)-1,3-thiazole-5-sulfonamide |
| PubChem CID | 69132480 |
| Molecular Formula | C6H6N4O2S2 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 229.99 |
| IUPAC Name | 2-(1H-imidazol-5-yl)-1,3-thiazole-5-sulfonamide |
| SMILES | NS(=O)(=O)c1cnc(-c2cnc[nH]2)s1 |
| InChI | InChI=1S/C6H6N4O2S2/c7-14(11,12)5-2-9-6(13-5)4-1-8-3-10-4/h1-3H,(H,8,10)(H2,7,11,12) |
| InChIKey | WTWPTZYPILGKMF-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(1H-imidazol-5-yl)-1,3-thiazole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1H-imidazol-5-yl)-1,3-thiazole-5-sulfonamide?
The IUPAC name of 2-(1H-imidazol-5-yl)-1,3-thiazole-5-sulfonamide (CID 69132480) is 2-(1H-imidazol-5-yl)-1,3-thiazole-5-sulfonamide.
What is the SMILES notation for 2-(1H-imidazol-5-yl)-1,3-thiazole-5-sulfonamide?
The canonical SMILES for 2-(1H-imidazol-5-yl)-1,3-thiazole-5-sulfonamide is NS(=O)(=O)c1cnc(-c2cnc[nH]2)s1.
What is the InChIKey of 2-(1H-imidazol-5-yl)-1,3-thiazole-5-sulfonamide?
The InChIKey is WTWPTZYPILGKMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N4O2S2/c7-14(11,12)5-2-9-6(13-5)4-1-8-3-10-4/h1-3H,(H,8,10)(H2,7,11,12).
What are the key properties of 2-(1H-imidazol-5-yl)-1,3-thiazole-5-sulfonamide?
2-(1H-imidazol-5-yl)-1,3-thiazole-5-sulfonamide has a molecular weight of 230.27 g/mol, XLogP of 0.18, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1H-imidazol-5-yl)-1,3-thiazole-5-sulfonamide is sourced from PubChem (CID 69132480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).