About [3-amino-6-(4-aminopiperidin-1-yl)-4-(4-methylsulfonylphenyl)thieno[2,3-b]pyridin-2-yl] carbamate
[3-amino-6-(4-aminopiperidin-1-yl)-4-(4-methylsulfonylphenyl)thieno[2,3-b]pyridin-2-yl] carbamate (PubChem CID 69132561) has the molecular formula C20H23N5O4S2
and a molecular weight of 461.57 g/mol. Its IUPAC name is [3-amino-6-(4-aminopiperidin-1-yl)-4-(4-methylsulfonylphenyl)thieno[2,3-b]pyridin-2-yl] carbamate.
Molecular Properties
| Compound Name | [3-amino-6-(4-aminopiperidin-1-yl)-4-(4-methylsulfonylphenyl)thieno[2,3-b]pyridin-2-yl] carbamate |
| PubChem CID | 69132561 |
| Molecular Formula | C20H23N5O4S2 |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | [3-amino-6-(4-aminopiperidin-1-yl)-4-(4-methylsulfonylphenyl)thieno[2,3-b]pyridin-2-yl] carbamate |
| SMILES | CS(=O)(=O)c1ccc(-c2cc(N3CCC(N)CC3)nc3sc(OC(N)=O)c(N)c23)cc1 |
| InChI | InChI=1S/C20H23N5O4S2/c1-31(27,28)13-4-2-11(3-5-13)14-10-15(25-8-6-12(21)7-9-25)24-18-16(14)17(22)19(30-18)29-20(23)26/h2-5,10,12H,6-9,21-22H2,1H3,(H2,23,26) |
| InChIKey | GTOHTGRQLGTKIZ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 154.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze [3-amino-6-(4-aminopiperidin-1-yl)-4-(4-methylsulfonylphenyl)thieno[2,3-b]pyridin-2-yl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-amino-6-(4-aminopiperidin-1-yl)-4-(4-methylsulfonylphenyl)thieno[2,3-b]pyridin-2-yl] carbamate?
The IUPAC name of [3-amino-6-(4-aminopiperidin-1-yl)-4-(4-methylsulfonylphenyl)thieno[2,3-b]pyridin-2-yl] carbamate (CID 69132561) is [3-amino-6-(4-aminopiperidin-1-yl)-4-(4-methylsulfonylphenyl)thieno[2,3-b]pyridin-2-yl] carbamate.
What is the SMILES notation for [3-amino-6-(4-aminopiperidin-1-yl)-4-(4-methylsulfonylphenyl)thieno[2,3-b]pyridin-2-yl] carbamate?
The canonical SMILES for [3-amino-6-(4-aminopiperidin-1-yl)-4-(4-methylsulfonylphenyl)thieno[2,3-b]pyridin-2-yl] carbamate is CS(=O)(=O)c1ccc(-c2cc(N3CCC(N)CC3)nc3sc(OC(N)=O)c(N)c23)cc1.
What is the InChIKey of [3-amino-6-(4-aminopiperidin-1-yl)-4-(4-methylsulfonylphenyl)thieno[2,3-b]pyridin-2-yl] carbamate?
The InChIKey is GTOHTGRQLGTKIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23N5O4S2/c1-31(27,28)13-4-2-11(3-5-13)14-10-15(25-8-6-12(21)7-9-25)24-18-16(14)17(22)19(30-18)29-20(23)26/h2-5,10,12H,6-9,21-22H2,1H3,(H2,23,26).
What are the key properties of [3-amino-6-(4-aminopiperidin-1-yl)-4-(4-methylsulfonylphenyl)thieno[2,3-b]pyridin-2-yl] carbamate?
[3-amino-6-(4-aminopiperidin-1-yl)-4-(4-methylsulfonylphenyl)thieno[2,3-b]pyridin-2-yl] carbamate has a molecular weight of 461.57 g/mol, XLogP of 2.33, 4 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [3-amino-6-(4-aminopiperidin-1-yl)-4-(4-methylsulfonylphenyl)thieno[2,3-b]pyridin-2-yl] carbamate is sourced from PubChem (CID 69132561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).