C22H20N2O2 — CID 69132844
2-cyano-3-(2-methoxyphenyl)-2-methyl-3-naphthalen-1-ylpropanamide (PubChem CID 69132844) has the molecular formula C22H20N2O2 and a molecular weight of 344.41 g/mol. Its IUPAC name is 2-cyano-3-(2-methoxyphenyl)-2-methyl-3-naphthalen-1-ylpropanamide.
| Compound Name | 2-cyano-3-(2-methoxyphenyl)-2-methyl-3-naphthalen-1-ylpropanamide |
|---|---|
| PubChem CID | 69132844 |
| Molecular Formula | C22H20N2O2 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 2-cyano-3-(2-methoxyphenyl)-2-methyl-3-naphthalen-1-ylpropanamide |
| SMILES | COc1ccccc1C(c1cccc2ccccc12)C(C)(C#N)C(N)=O |
| InChI | InChI=1S/C22H20N2O2/c1-22(14-23,21(24)25)20(18-11-5-6-13-19(18)26-2)17-12-7-9-15-8-3-4-10-16(15)17/h3-13,20H,1-2H3,(H2,24,25) |
| InChIKey | ZJAOLUVZAYWNDE-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 76.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |