About [6-[[3,6-dioxo-5-(2-phenylethylidene)piperazin-2-ylidene]methyl]-3-pyridinyl] acetate
[6-[[3,6-dioxo-5-(2-phenylethylidene)piperazin-2-ylidene]methyl]-3-pyridinyl] acetate (PubChem CID 69132886) has the molecular formula C20H17N3O4
and a molecular weight of 363.37 g/mol. Its IUPAC name is [6-[[3,6-dioxo-5-(2-phenylethylidene)piperazin-2-ylidene]methyl]-3-pyridinyl] acetate.
Molecular Properties
| Compound Name | [6-[[3,6-dioxo-5-(2-phenylethylidene)piperazin-2-ylidene]methyl]-3-pyridinyl] acetate |
| PubChem CID | 69132886 |
| Molecular Formula | C20H17N3O4 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | [6-[[3,6-dioxo-5-(2-phenylethylidene)piperazin-2-ylidene]methyl]-3-pyridinyl] acetate |
| SMILES | CC(=O)Oc1ccc(C=c2[nH]c(=O)c(=CCc3ccccc3)[nH]c2=O)nc1 |
| InChI | InChI=1S/C20H17N3O4/c1-13(24)27-16-9-8-15(21-12-16)11-18-20(26)22-17(19(25)23-18)10-7-14-5-3-2-4-6-14/h2-6,8-12H,7H2,1H3,(H,22,26)(H,23,25) |
| InChIKey | BLLKAASUNHOEBB-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 104.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [6-[[3,6-dioxo-5-(2-phenylethylidene)piperazin-2-ylidene]methyl]-3-pyridinyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-[[3,6-dioxo-5-(2-phenylethylidene)piperazin-2-ylidene]methyl]-3-pyridinyl] acetate?
The IUPAC name of [6-[[3,6-dioxo-5-(2-phenylethylidene)piperazin-2-ylidene]methyl]-3-pyridinyl] acetate (CID 69132886) is [6-[[3,6-dioxo-5-(2-phenylethylidene)piperazin-2-ylidene]methyl]-3-pyridinyl] acetate.
What is the SMILES notation for [6-[[3,6-dioxo-5-(2-phenylethylidene)piperazin-2-ylidene]methyl]-3-pyridinyl] acetate?
The canonical SMILES for [6-[[3,6-dioxo-5-(2-phenylethylidene)piperazin-2-ylidene]methyl]-3-pyridinyl] acetate is CC(=O)Oc1ccc(C=c2[nH]c(=O)c(=CCc3ccccc3)[nH]c2=O)nc1.
What is the InChIKey of [6-[[3,6-dioxo-5-(2-phenylethylidene)piperazin-2-ylidene]methyl]-3-pyridinyl] acetate?
The InChIKey is BLLKAASUNHOEBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17N3O4/c1-13(24)27-16-9-8-15(21-12-16)11-18-20(26)22-17(19(25)23-18)10-7-14-5-3-2-4-6-14/h2-6,8-12H,7H2,1H3,(H,22,26)(H,23,25).
What are the key properties of [6-[[3,6-dioxo-5-(2-phenylethylidene)piperazin-2-ylidene]methyl]-3-pyridinyl] acetate?
[6-[[3,6-dioxo-5-(2-phenylethylidene)piperazin-2-ylidene]methyl]-3-pyridinyl] acetate has a molecular weight of 363.37 g/mol, XLogP of 0.24, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [6-[[3,6-dioxo-5-(2-phenylethylidene)piperazin-2-ylidene]methyl]-3-pyridinyl] acetate is sourced from PubChem (CID 69132886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).