C30H28N4O2 — CID 69132907
2,5-bis[(5-phenylmethoxy-2-pyridinyl)methylidene]piperazine (PubChem CID 69132907) has the molecular formula C30H28N4O2 and a molecular weight of 476.58 g/mol. Its IUPAC name is 2,5-bis[(5-phenylmethoxy-2-pyridinyl)methylidene]piperazine.
| Compound Name | 2,5-bis[(5-phenylmethoxy-2-pyridinyl)methylidene]piperazine |
|---|---|
| PubChem CID | 69132907 |
| Molecular Formula | C30H28N4O2 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.22 |
| IUPAC Name | 2,5-bis[(5-phenylmethoxy-2-pyridinyl)methylidene]piperazine |
| SMILES | C(=C1CNC(=Cc2ccc(OCc3ccccc3)cn2)CN1)c1ccc(OCc2ccccc2)cn1 |
| InChI | InChI=1S/C30H28N4O2/c1-3-7-23(8-4-1)21-35-29-13-11-25(33-19-29)15-27-17-32-28(18-31-27)16-26-12-14-30(20-34-26)36-22-24-9-5-2-6-10-24/h1-16,19-20,31-32H,17-18,21-22H2 |
| InChIKey | RFOLTZSJVPUUNP-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |