C15H15ClN2 — CID 69133778
(6R)-6-[2-(3-chlorophenyl)ethynyl]-1,2,3,4,6,7-hexahydropyrrolo[1,2-a]pyrazine (PubChem CID 69133778) has the molecular formula C15H15ClN2 and a molecular weight of 258.75 g/mol. Its IUPAC name is (6R)-6-[2-(3-chlorophenyl)ethynyl]-1,2,3,4,6,7-hexahydropyrrolo[1,2-a]pyrazine.
| Compound Name | (6R)-6-[2-(3-chlorophenyl)ethynyl]-1,2,3,4,6,7-hexahydropyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 69133778 |
| Molecular Formula | C15H15ClN2 |
| Molecular Weight | 258.75 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | (6R)-6-[2-(3-chlorophenyl)ethynyl]-1,2,3,4,6,7-hexahydropyrrolo[1,2-a]pyrazine |
| SMILES | Clc1cccc(C#C[C@H]2CC=C3CNCCN32)c1 |
| InChI | InChI=1S/C15H15ClN2/c16-13-3-1-2-12(10-13)4-5-14-6-7-15-11-17-8-9-18(14)15/h1-3,7,10,14,17H,6,8-9,11H2/t14-/m0/s1 |
| InChIKey | UCDJFOLWKDXYDE-AWEZNQCLSA-N |
| XLogP | 2.25 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.75 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|