About 3-[hydroxy-[(1R,2R)-2-phenylcyclopropyl]methylidene]-5-(2-phenylethyl)oxolane-2,4-dione
3-[hydroxy-[(1R,2R)-2-phenylcyclopropyl]methylidene]-5-(2-phenylethyl)oxolane-2,4-dione (PubChem CID 69134277) has the molecular formula C22H20O4
and a molecular weight of 348.40 g/mol. Its IUPAC name is 3-[hydroxy-[(1R,2R)-2-phenylcyclopropyl]methylidene]-5-(2-phenylethyl)oxolane-2,4-dione.
Molecular Properties
| Compound Name | 3-[hydroxy-[(1R,2R)-2-phenylcyclopropyl]methylidene]-5-(2-phenylethyl)oxolane-2,4-dione |
| PubChem CID | 69134277 |
| Molecular Formula | C22H20O4 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 3-[hydroxy-[(1R,2R)-2-phenylcyclopropyl]methylidene]-5-(2-phenylethyl)oxolane-2,4-dione |
| SMILES | O=C1OC(CCc2ccccc2)C(=O)C1=C(O)[C@@H]1C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C22H20O4/c23-20(17-13-16(17)15-9-5-2-6-10-15)19-21(24)18(26-22(19)25)12-11-14-7-3-1-4-8-14/h1-10,16-18,23H,11-13H2/t16-,17+,18?/m0/s1 |
| InChIKey | TZQSARNSMZZYFO-MYFVLZFPSA-N |
| XLogP | 3.73 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze 3-[hydroxy-[(1R,2R)-2-phenylcyclopropyl]methylidene]-5-(2-phenylethyl)oxolane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[hydroxy-[(1R,2R)-2-phenylcyclopropyl]methylidene]-5-(2-phenylethyl)oxolane-2,4-dione?
The IUPAC name of 3-[hydroxy-[(1R,2R)-2-phenylcyclopropyl]methylidene]-5-(2-phenylethyl)oxolane-2,4-dione (CID 69134277) is 3-[hydroxy-[(1R,2R)-2-phenylcyclopropyl]methylidene]-5-(2-phenylethyl)oxolane-2,4-dione.
What is the SMILES notation for 3-[hydroxy-[(1R,2R)-2-phenylcyclopropyl]methylidene]-5-(2-phenylethyl)oxolane-2,4-dione?
The canonical SMILES for 3-[hydroxy-[(1R,2R)-2-phenylcyclopropyl]methylidene]-5-(2-phenylethyl)oxolane-2,4-dione is O=C1OC(CCc2ccccc2)C(=O)C1=C(O)[C@@H]1C[C@H]1c1ccccc1.
What is the InChIKey of 3-[hydroxy-[(1R,2R)-2-phenylcyclopropyl]methylidene]-5-(2-phenylethyl)oxolane-2,4-dione?
The InChIKey is TZQSARNSMZZYFO-MYFVLZFPSA-N. The full InChI is InChI=1S/C22H20O4/c23-20(17-13-16(17)15-9-5-2-6-10-15)19-21(24)18(26-22(19)25)12-11-14-7-3-1-4-8-14/h1-10,16-18,23H,11-13H2/t16-,17+,18?/m0/s1.
What are the key properties of 3-[hydroxy-[(1R,2R)-2-phenylcyclopropyl]methylidene]-5-(2-phenylethyl)oxolane-2,4-dione?
3-[hydroxy-[(1R,2R)-2-phenylcyclopropyl]methylidene]-5-(2-phenylethyl)oxolane-2,4-dione has a molecular weight of 348.40 g/mol, XLogP of 3.73, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[hydroxy-[(1R,2R)-2-phenylcyclopropyl]methylidene]-5-(2-phenylethyl)oxolane-2,4-dione is sourced from PubChem (CID 69134277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).