About 2-cyano-3-(3-ethoxy-4-hydroxy-2-nitrophenyl)-N,N-diethylprop-2-enamide
2-cyano-3-(3-ethoxy-4-hydroxy-2-nitrophenyl)-N,N-diethylprop-2-enamide (PubChem CID 69134344) has the molecular formula C16H19N3O5
and a molecular weight of 333.34 g/mol. Its IUPAC name is 2-cyano-3-(3-ethoxy-4-hydroxy-2-nitrophenyl)-N,N-diethylprop-2-enamide.
Molecular Properties
| Compound Name | 2-cyano-3-(3-ethoxy-4-hydroxy-2-nitrophenyl)-N,N-diethylprop-2-enamide |
| PubChem CID | 69134344 |
| Molecular Formula | C16H19N3O5 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 2-cyano-3-(3-ethoxy-4-hydroxy-2-nitrophenyl)-N,N-diethylprop-2-enamide |
| SMILES | CCOc1c(O)ccc(C=C(C#N)C(=O)N(CC)CC)c1[N+](=O)[O-] |
| InChI | InChI=1S/C16H19N3O5/c1-4-18(5-2)16(21)12(10-17)9-11-7-8-13(20)15(24-6-3)14(11)19(22)23/h7-9,20H,4-6H2,1-3H3 |
| InChIKey | OAQXIGFJXBCNAT-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 116.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-cyano-3-(3-ethoxy-4-hydroxy-2-nitrophenyl)-N,N-diethylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyano-3-(3-ethoxy-4-hydroxy-2-nitrophenyl)-N,N-diethylprop-2-enamide?
The IUPAC name of 2-cyano-3-(3-ethoxy-4-hydroxy-2-nitrophenyl)-N,N-diethylprop-2-enamide (CID 69134344) is 2-cyano-3-(3-ethoxy-4-hydroxy-2-nitrophenyl)-N,N-diethylprop-2-enamide.
What is the SMILES notation for 2-cyano-3-(3-ethoxy-4-hydroxy-2-nitrophenyl)-N,N-diethylprop-2-enamide?
The canonical SMILES for 2-cyano-3-(3-ethoxy-4-hydroxy-2-nitrophenyl)-N,N-diethylprop-2-enamide is CCOc1c(O)ccc(C=C(C#N)C(=O)N(CC)CC)c1[N+](=O)[O-].
What is the InChIKey of 2-cyano-3-(3-ethoxy-4-hydroxy-2-nitrophenyl)-N,N-diethylprop-2-enamide?
The InChIKey is OAQXIGFJXBCNAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N3O5/c1-4-18(5-2)16(21)12(10-17)9-11-7-8-13(20)15(24-6-3)14(11)19(22)23/h7-9,20H,4-6H2,1-3H3.
What are the key properties of 2-cyano-3-(3-ethoxy-4-hydroxy-2-nitrophenyl)-N,N-diethylprop-2-enamide?
2-cyano-3-(3-ethoxy-4-hydroxy-2-nitrophenyl)-N,N-diethylprop-2-enamide has a molecular weight of 333.34 g/mol, XLogP of 2.47, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyano-3-(3-ethoxy-4-hydroxy-2-nitrophenyl)-N,N-diethylprop-2-enamide is sourced from PubChem (CID 69134344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).