C17H15N — CID 69134421
11-azatetracyclo[12.4.0.01,6.07,12]octadeca-2,4,7,9,13,15,17-heptaene (PubChem CID 69134421) has the molecular formula C17H15N and a molecular weight of 233.31 g/mol. Its IUPAC name is 11-azatetracyclo[12.4.0.01,6.07,12]octadeca-2,4,7,9,13,15,17-heptaene.
| Compound Name | 11-azatetracyclo[12.4.0.01,6.07,12]octadeca-2,4,7,9,13,15,17-heptaene |
|---|---|
| PubChem CID | 69134421 |
| Molecular Formula | C17H15N |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 11-azatetracyclo[12.4.0.01,6.07,12]octadeca-2,4,7,9,13,15,17-heptaene |
| SMILES | C1=CNC2C=C3C=CC=CC34C=CC=CC4C2=C1 |
| InChI | InChI=1S/C17H15N/c1-3-9-17-10-4-2-8-15(17)14-7-5-11-18-16(14)12-13(17)6-1/h1-12,15-16,18H |
| InChIKey | AQRWFSJBTBSUDE-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |