C17H13N — CID 69134422
12-azatetracyclo[12.4.0.01,6.06,11]octadeca-2,4,7,9,11,13,15,17-octaene (PubChem CID 69134422) has the molecular formula C17H13N and a molecular weight of 231.30 g/mol. Its IUPAC name is 12-azatetracyclo[12.4.0.01,6.06,11]octadeca-2,4,7,9,11,13,15,17-octaene.
| Compound Name | 12-azatetracyclo[12.4.0.01,6.06,11]octadeca-2,4,7,9,11,13,15,17-octaene |
|---|---|
| PubChem CID | 69134422 |
| Molecular Formula | C17H13N |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 12-azatetracyclo[12.4.0.01,6.06,11]octadeca-2,4,7,9,11,13,15,17-octaene |
| SMILES | C1=CC2=CN=C3C=CC=CC34C=CC=CC24C=C1 |
| InChI | InChI=1S/C17H13N/c1-3-9-16-10-5-6-12-17(16)11-4-2-8-15(17)18-13-14(16)7-1/h1-13H |
| InChIKey | HWHDDKSEEJTFKW-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |