C18H20O4 — CID 69134520
3-[hydroxy-[(1R,2R)-2-phenylcyclopropyl]methylidene]-5-(2-methylpropyl)oxolane-2,4-dione (PubChem CID 69134520) has the molecular formula C18H20O4 and a molecular weight of 300.35 g/mol. Its IUPAC name is 3-[hydroxy-[(1R,2R)-2-phenylcyclopropyl]methylidene]-5-(2-methylpropyl)oxolane-2,4-dione.
| Compound Name | 3-[hydroxy-[(1R,2R)-2-phenylcyclopropyl]methylidene]-5-(2-methylpropyl)oxolane-2,4-dione |
|---|---|
| PubChem CID | 69134520 |
| Molecular Formula | C18H20O4 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 3-[hydroxy-[(1R,2R)-2-phenylcyclopropyl]methylidene]-5-(2-methylpropyl)oxolane-2,4-dione |
| SMILES | CC(C)CC1OC(=O)C(=C(O)[C@@H]2C[C@H]2c2ccccc2)C1=O |
| InChI | InChI=1S/C18H20O4/c1-10(2)8-14-17(20)15(18(21)22-14)16(19)13-9-12(13)11-6-4-3-5-7-11/h3-7,10,12-14,19H,8-9H2,1-2H3/t12-,13+,14?/m0/s1 |
| InChIKey | JDPRAFHXGXKMLJ-WLDKUNSKSA-N |
| XLogP | 3.14 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|