About [(3S)-oxolan-3-yl] (2S)-2,3-diamino-2-(heptan-4-ylsulfonylmethyl)-3-oxopropanoate
[(3S)-oxolan-3-yl] (2S)-2,3-diamino-2-(heptan-4-ylsulfonylmethyl)-3-oxopropanoate (PubChem CID 69134996) has the molecular formula C15H28N2O6S
and a molecular weight of 364.46 g/mol. Its IUPAC name is [(3S)-oxolan-3-yl] (2S)-2,3-diamino-2-(heptan-4-ylsulfonylmethyl)-3-oxopropanoate.
Molecular Properties
| Compound Name | [(3S)-oxolan-3-yl] (2S)-2,3-diamino-2-(heptan-4-ylsulfonylmethyl)-3-oxopropanoate |
| PubChem CID | 69134996 |
| Molecular Formula | C15H28N2O6S |
| Molecular Weight | 364.46 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | [(3S)-oxolan-3-yl] (2S)-2,3-diamino-2-(heptan-4-ylsulfonylmethyl)-3-oxopropanoate |
| SMILES | CCCC(CCC)S(=O)(=O)C[C@](N)(C(N)=O)C(=O)O[C@H]1CCOC1 |
| InChI | InChI=1S/C15H28N2O6S/c1-3-5-12(6-4-2)24(20,21)10-15(17,13(16)18)14(19)23-11-7-8-22-9-11/h11-12H,3-10,17H2,1-2H3,(H2,16,18)/t11-,15-/m0/s1 |
| InChIKey | LNCLXBRMVOTHOI-NHYWBVRUSA-N |
| XLogP | -0.12 |
| TPSA | 138.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.46 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze [(3S)-oxolan-3-yl] (2S)-2,3-diamino-2-(heptan-4-ylsulfonylmethyl)-3-oxopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S)-oxolan-3-yl] (2S)-2,3-diamino-2-(heptan-4-ylsulfonylmethyl)-3-oxopropanoate?
The IUPAC name of [(3S)-oxolan-3-yl] (2S)-2,3-diamino-2-(heptan-4-ylsulfonylmethyl)-3-oxopropanoate (CID 69134996) is [(3S)-oxolan-3-yl] (2S)-2,3-diamino-2-(heptan-4-ylsulfonylmethyl)-3-oxopropanoate.
What is the SMILES notation for [(3S)-oxolan-3-yl] (2S)-2,3-diamino-2-(heptan-4-ylsulfonylmethyl)-3-oxopropanoate?
The canonical SMILES for [(3S)-oxolan-3-yl] (2S)-2,3-diamino-2-(heptan-4-ylsulfonylmethyl)-3-oxopropanoate is CCCC(CCC)S(=O)(=O)C[C@](N)(C(N)=O)C(=O)O[C@H]1CCOC1.
What is the InChIKey of [(3S)-oxolan-3-yl] (2S)-2,3-diamino-2-(heptan-4-ylsulfonylmethyl)-3-oxopropanoate?
The InChIKey is LNCLXBRMVOTHOI-NHYWBVRUSA-N. The full InChI is InChI=1S/C15H28N2O6S/c1-3-5-12(6-4-2)24(20,21)10-15(17,13(16)18)14(19)23-11-7-8-22-9-11/h11-12H,3-10,17H2,1-2H3,(H2,16,18)/t11-,15-/m0/s1.
What are the key properties of [(3S)-oxolan-3-yl] (2S)-2,3-diamino-2-(heptan-4-ylsulfonylmethyl)-3-oxopropanoate?
[(3S)-oxolan-3-yl] (2S)-2,3-diamino-2-(heptan-4-ylsulfonylmethyl)-3-oxopropanoate has a molecular weight of 364.46 g/mol, XLogP of -0.12, 10 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S)-oxolan-3-yl] (2S)-2,3-diamino-2-(heptan-4-ylsulfonylmethyl)-3-oxopropanoate is sourced from PubChem (CID 69134996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).