About 4,5-dimethyl-3-(sulfinatoamino)-1,2-oxazole
4,5-dimethyl-3-(sulfinatoamino)-1,2-oxazole (PubChem CID 69135005) has the molecular formula C5H7N2O3S-
and a molecular weight of 175.19 g/mol. Its IUPAC name is 4,5-dimethyl-3-(sulfinatoamino)-1,2-oxazole.
Molecular Properties
| Compound Name | 4,5-dimethyl-3-(sulfinatoamino)-1,2-oxazole |
| PubChem CID | 69135005 |
| Molecular Formula | C5H7N2O3S- |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.02 |
| IUPAC Name | 4,5-dimethyl-3-(sulfinatoamino)-1,2-oxazole |
| SMILES | Cc1onc(NS(=O)[O-])c1C |
| InChI | InChI=1S/C5H8N2O3S/c1-3-4(2)10-6-5(3)7-11(8)9/h1-2H3,(H,6,7)(H,8,9)/p-1 |
| InChIKey | NARBFKGKYHQXMD-UHFFFAOYSA-M |
| XLogP | 0.50 |
| TPSA | 78.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 4,5-dimethyl-3-(sulfinatoamino)-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethyl-3-(sulfinatoamino)-1,2-oxazole?
The IUPAC name of 4,5-dimethyl-3-(sulfinatoamino)-1,2-oxazole (CID 69135005) is 4,5-dimethyl-3-(sulfinatoamino)-1,2-oxazole.
What is the SMILES notation for 4,5-dimethyl-3-(sulfinatoamino)-1,2-oxazole?
The canonical SMILES for 4,5-dimethyl-3-(sulfinatoamino)-1,2-oxazole is Cc1onc(NS(=O)[O-])c1C.
What is the InChIKey of 4,5-dimethyl-3-(sulfinatoamino)-1,2-oxazole?
The InChIKey is NARBFKGKYHQXMD-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H8N2O3S/c1-3-4(2)10-6-5(3)7-11(8)9/h1-2H3,(H,6,7)(H,8,9)/p-1.
What are the key properties of 4,5-dimethyl-3-(sulfinatoamino)-1,2-oxazole?
4,5-dimethyl-3-(sulfinatoamino)-1,2-oxazole has a molecular weight of 175.19 g/mol, XLogP of 0.50, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethyl-3-(sulfinatoamino)-1,2-oxazole is sourced from PubChem (CID 69135005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).