C26H37N3O4Si — CID 69135076
7-hydroxy-6-(2-hydroxy-3-phenylpropyl)-N,N,2-trimethyl-3-(2-trimethylsilylethoxymethyl)benzimidazole-5-carboxamide (PubChem CID 69135076) has the molecular formula C26H37N3O4Si and a molecular weight of 483.69 g/mol. Its IUPAC name is 7-hydroxy-6-(2-hydroxy-3-phenylpropyl)-N,N,2-trimethyl-3-(2-trimethylsilylethoxymethyl)benzimidazole-5-carboxamide.
| Compound Name | 7-hydroxy-6-(2-hydroxy-3-phenylpropyl)-N,N,2-trimethyl-3-(2-trimethylsilylethoxymethyl)benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 69135076 |
| Molecular Formula | C26H37N3O4Si |
| Molecular Weight | 483.69 g/mol |
| Exact Mass | 483.26 |
| IUPAC Name | 7-hydroxy-6-(2-hydroxy-3-phenylpropyl)-N,N,2-trimethyl-3-(2-trimethylsilylethoxymethyl)benzimidazole-5-carboxamide |
| SMILES | Cc1nc2c(O)c(CC(O)Cc3ccccc3)c(C(=O)N(C)C)cc2n1COCC[Si](C)(C)C |
| InChI | InChI=1S/C26H37N3O4Si/c1-18-27-24-23(29(18)17-33-12-13-34(4,5)6)16-22(26(32)28(2)3)21(25(24)31)15-20(30)14-19-10-8-7-9-11-19/h7-11,16,20,30-31H,12-15,17H2,1-6H3 |
| InChIKey | OVRGTEQWTNBLFT-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.69 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|