C33H35NO7 — CID 69135262
tert-butyl N-[1-[2,4-dioxo-5-(2-phenylethyl)oxolan-3-ylidene]-1-hydroxy-3-(4-phenylmethoxyphenyl)propan-2-yl]carbamate (PubChem CID 69135262) has the molecular formula C33H35NO7 and a molecular weight of 557.64 g/mol. Its IUPAC name is tert-butyl N-[1-[2,4-dioxo-5-(2-phenylethyl)oxolan-3-ylidene]-1-hydroxy-3-(4-phenylmethoxyphenyl)propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[2,4-dioxo-5-(2-phenylethyl)oxolan-3-ylidene]-1-hydroxy-3-(4-phenylmethoxyphenyl)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 69135262 |
| Molecular Formula | C33H35NO7 |
| Molecular Weight | 557.64 g/mol |
| Exact Mass | 557.24 |
| IUPAC Name | tert-butyl N-[1-[2,4-dioxo-5-(2-phenylethyl)oxolan-3-ylidene]-1-hydroxy-3-(4-phenylmethoxyphenyl)propan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccc(OCc2ccccc2)cc1)C(O)=C1C(=O)OC(CCc2ccccc2)C1=O |
| InChI | InChI=1S/C33H35NO7/c1-33(2,3)41-32(38)34-26(20-23-14-17-25(18-15-23)39-21-24-12-8-5-9-13-24)29(35)28-30(36)27(40-31(28)37)19-16-22-10-6-4-7-11-22/h4-15,17-18,26-27,35H,16,19-21H2,1-3H3,(H,34,38) |
| InChIKey | GUCFZUZVRKPUNY-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.64 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|