About methyl 4-but-1-enylbenzoate
methyl 4-but-1-enylbenzoate (PubChem CID 69135322) has the molecular formula C12H14O2
and a molecular weight of 190.24 g/mol. Its IUPAC name is methyl 4-but-1-enylbenzoate.
Molecular Properties
| Compound Name | methyl 4-but-1-enylbenzoate |
| PubChem CID | 69135322 |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | methyl 4-but-1-enylbenzoate |
| SMILES | CCC=Cc1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C12H14O2/c1-3-4-5-10-6-8-11(9-7-10)12(13)14-2/h4-9H,3H2,1-2H3 |
| InChIKey | CABKTJJRDOXBNZ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methyl 4-but-1-enylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-but-1-enylbenzoate?
The IUPAC name of methyl 4-but-1-enylbenzoate (CID 69135322) is methyl 4-but-1-enylbenzoate.
What is the SMILES notation for methyl 4-but-1-enylbenzoate?
The canonical SMILES for methyl 4-but-1-enylbenzoate is CCC=Cc1ccc(C(=O)OC)cc1.
What is the InChIKey of methyl 4-but-1-enylbenzoate?
The InChIKey is CABKTJJRDOXBNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O2/c1-3-4-5-10-6-8-11(9-7-10)12(13)14-2/h4-9H,3H2,1-2H3.
What are the key properties of methyl 4-but-1-enylbenzoate?
methyl 4-but-1-enylbenzoate has a molecular weight of 190.24 g/mol, XLogP of 2.90, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-but-1-enylbenzoate is sourced from PubChem (CID 69135322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).