C27H29NO6 — CID 69135366
tert-butyl (3S)-3-[[2,4-dioxo-5-(2-phenylethyl)oxolan-3-ylidene]-hydroxymethyl]-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 69135366) has the molecular formula C27H29NO6 and a molecular weight of 463.53 g/mol. Its IUPAC name is tert-butyl (3S)-3-[[2,4-dioxo-5-(2-phenylethyl)oxolan-3-ylidene]-hydroxymethyl]-3,4-dihydro-1H-isoquinoline-2-carboxylate.
| Compound Name | tert-butyl (3S)-3-[[2,4-dioxo-5-(2-phenylethyl)oxolan-3-ylidene]-hydroxymethyl]-3,4-dihydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 69135366 |
| Molecular Formula | C27H29NO6 |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | tert-butyl (3S)-3-[[2,4-dioxo-5-(2-phenylethyl)oxolan-3-ylidene]-hydroxymethyl]-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1Cc2ccccc2C[C@H]1C(O)=C1C(=O)OC(CCc2ccccc2)C1=O |
| InChI | InChI=1S/C27H29NO6/c1-27(2,3)34-26(32)28-16-19-12-8-7-11-18(19)15-20(28)23(29)22-24(30)21(33-25(22)31)14-13-17-9-5-4-6-10-17/h4-12,20-21,29H,13-16H2,1-3H3/t20-,21?/m0/s1 |
| InChIKey | NYXHLZJXOHJLAM-BGERDNNASA-N |
| XLogP | 4.29 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|