C11H16F2O5 — CID 69135603
3-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-difluoro-3-hydroxyhex-5-enoic acid (PubChem CID 69135603) has the molecular formula C11H16F2O5 and a molecular weight of 266.24 g/mol. Its IUPAC name is 3-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-difluoro-3-hydroxyhex-5-enoic acid.
| Compound Name | 3-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-difluoro-3-hydroxyhex-5-enoic acid |
|---|---|
| PubChem CID | 69135603 |
| Molecular Formula | C11H16F2O5 |
| Molecular Weight | 266.24 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | 3-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-difluoro-3-hydroxyhex-5-enoic acid |
| SMILES | C=CCC(O)(C1COC(C)(C)O1)C(F)(F)C(=O)O |
| InChI | InChI=1S/C11H16F2O5/c1-4-5-10(16,11(12,13)8(14)15)7-6-17-9(2,3)18-7/h4,7,16H,1,5-6H2,2-3H3,(H,14,15) |
| InChIKey | JMJOZXVLJHDOOG-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.24 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|