About ethyl 4-[3,3-dimethylbutanoyl(dimethyl)silyl]oxycyclohexane-1-carboxylate
ethyl 4-[3,3-dimethylbutanoyl(dimethyl)silyl]oxycyclohexane-1-carboxylate (PubChem CID 69136300) has the molecular formula C17H32O4Si
and a molecular weight of 328.53 g/mol. Its IUPAC name is ethyl 4-[3,3-dimethylbutanoyl(dimethyl)silyl]oxycyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-[3,3-dimethylbutanoyl(dimethyl)silyl]oxycyclohexane-1-carboxylate |
| PubChem CID | 69136300 |
| Molecular Formula | C17H32O4Si |
| Molecular Weight | 328.53 g/mol |
| Exact Mass | 328.21 |
| IUPAC Name | ethyl 4-[3,3-dimethylbutanoyl(dimethyl)silyl]oxycyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1CCC(O[Si](C)(C)C(=O)CC(C)(C)C)CC1 |
| InChI | InChI=1S/C17H32O4Si/c1-7-20-16(19)13-8-10-14(11-9-13)21-22(5,6)15(18)12-17(2,3)4/h13-14H,7-12H2,1-6H3 |
| InChIKey | LDUKBABANNHHEO-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.53 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-[3,3-dimethylbutanoyl(dimethyl)silyl]oxycyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[3,3-dimethylbutanoyl(dimethyl)silyl]oxycyclohexane-1-carboxylate?
The IUPAC name of ethyl 4-[3,3-dimethylbutanoyl(dimethyl)silyl]oxycyclohexane-1-carboxylate (CID 69136300) is ethyl 4-[3,3-dimethylbutanoyl(dimethyl)silyl]oxycyclohexane-1-carboxylate.
What is the SMILES notation for ethyl 4-[3,3-dimethylbutanoyl(dimethyl)silyl]oxycyclohexane-1-carboxylate?
The canonical SMILES for ethyl 4-[3,3-dimethylbutanoyl(dimethyl)silyl]oxycyclohexane-1-carboxylate is CCOC(=O)C1CCC(O[Si](C)(C)C(=O)CC(C)(C)C)CC1.
What is the InChIKey of ethyl 4-[3,3-dimethylbutanoyl(dimethyl)silyl]oxycyclohexane-1-carboxylate?
The InChIKey is LDUKBABANNHHEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H32O4Si/c1-7-20-16(19)13-8-10-14(11-9-13)21-22(5,6)15(18)12-17(2,3)4/h13-14H,7-12H2,1-6H3.
What are the key properties of ethyl 4-[3,3-dimethylbutanoyl(dimethyl)silyl]oxycyclohexane-1-carboxylate?
ethyl 4-[3,3-dimethylbutanoyl(dimethyl)silyl]oxycyclohexane-1-carboxylate has a molecular weight of 328.53 g/mol, XLogP of 3.87, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[3,3-dimethylbutanoyl(dimethyl)silyl]oxycyclohexane-1-carboxylate is sourced from PubChem (CID 69136300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).