About 1-methoxy-3-nitro-4-phenylcyclohexa-2,5-diene-1-carbonitrile
1-methoxy-3-nitro-4-phenylcyclohexa-2,5-diene-1-carbonitrile (PubChem CID 69136367) has the molecular formula C14H12N2O3
and a molecular weight of 256.26 g/mol. Its IUPAC name is 1-methoxy-3-nitro-4-phenylcyclohexa-2,5-diene-1-carbonitrile.
Molecular Properties
| Compound Name | 1-methoxy-3-nitro-4-phenylcyclohexa-2,5-diene-1-carbonitrile |
| PubChem CID | 69136367 |
| Molecular Formula | C14H12N2O3 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 1-methoxy-3-nitro-4-phenylcyclohexa-2,5-diene-1-carbonitrile |
| SMILES | COC1(C#N)C=CC(c2ccccc2)C([N+](=O)[O-])=C1 |
| InChI | InChI=1S/C14H12N2O3/c1-19-14(10-15)8-7-12(13(9-14)16(17)18)11-5-3-2-4-6-11/h2-9,12H,1H3 |
| InChIKey | ROVFUDUBNLDXIZ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 76.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxy-3-nitro-4-phenylcyclohexa-2,5-diene-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-3-nitro-4-phenylcyclohexa-2,5-diene-1-carbonitrile?
The IUPAC name of 1-methoxy-3-nitro-4-phenylcyclohexa-2,5-diene-1-carbonitrile (CID 69136367) is 1-methoxy-3-nitro-4-phenylcyclohexa-2,5-diene-1-carbonitrile.
What is the SMILES notation for 1-methoxy-3-nitro-4-phenylcyclohexa-2,5-diene-1-carbonitrile?
The canonical SMILES for 1-methoxy-3-nitro-4-phenylcyclohexa-2,5-diene-1-carbonitrile is COC1(C#N)C=CC(c2ccccc2)C([N+](=O)[O-])=C1.
What is the InChIKey of 1-methoxy-3-nitro-4-phenylcyclohexa-2,5-diene-1-carbonitrile?
The InChIKey is ROVFUDUBNLDXIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2O3/c1-19-14(10-15)8-7-12(13(9-14)16(17)18)11-5-3-2-4-6-11/h2-9,12H,1H3.
What are the key properties of 1-methoxy-3-nitro-4-phenylcyclohexa-2,5-diene-1-carbonitrile?
1-methoxy-3-nitro-4-phenylcyclohexa-2,5-diene-1-carbonitrile has a molecular weight of 256.26 g/mol, XLogP of 2.41, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-3-nitro-4-phenylcyclohexa-2,5-diene-1-carbonitrile is sourced from PubChem (CID 69136367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).