C16H28Cl2O2 — CID 6913640
tritiomethyl (E)-7,11-dichloro-3,7,11-trimethyldodec-2-enoate (PubChem CID 6913640) has the molecular formula C16H28Cl2O2 and a molecular weight of 325.31 g/mol. Its IUPAC name is tritiomethyl (E)-7,11-dichloro-3,7,11-trimethyldodec-2-enoate.
| Compound Name | tritiomethyl (E)-7,11-dichloro-3,7,11-trimethyldodec-2-enoate |
|---|---|
| PubChem CID | 6913640 |
| Molecular Formula | C16H28Cl2O2 |
| Molecular Weight | 325.31 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | tritiomethyl (E)-7,11-dichloro-3,7,11-trimethyldodec-2-enoate |
| SMILES | [3H]COC(=O)/C=C(\C)CCCC(C)(Cl)CCCC(C)(C)Cl |
| InChI | InChI=1S/C16H28Cl2O2/c1-13(12-14(19)20-5)8-6-10-16(4,18)11-7-9-15(2,3)17/h12H,6-11H2,1-5H3/b13-12+/i5T |
| InChIKey | AWVGVHUVOTVOAQ-CRBMLKLTSA-N |
| XLogP | 5.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.31 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|