C15H26F2O5 — CID 69136594
ethyl 3-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-difluoro-3-pentoxypropanoate (PubChem CID 69136594) has the molecular formula C15H26F2O5 and a molecular weight of 324.36 g/mol. Its IUPAC name is ethyl 3-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-difluoro-3-pentoxypropanoate.
| Compound Name | ethyl 3-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-difluoro-3-pentoxypropanoate |
|---|---|
| PubChem CID | 69136594 |
| Molecular Formula | C15H26F2O5 |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | ethyl 3-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-difluoro-3-pentoxypropanoate |
| SMILES | CCCCCOC(C1COC(C)(C)O1)C(F)(F)C(=O)OCC |
| InChI | InChI=1S/C15H26F2O5/c1-5-7-8-9-20-12(11-10-21-14(3,4)22-11)15(16,17)13(18)19-6-2/h11-12H,5-10H2,1-4H3 |
| InChIKey | RZOGINAHPOWVOT-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|