C15H26F2O5 — CID 69136595
3-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-difluoro-3-pentoxypentanoic acid (PubChem CID 69136595) has the molecular formula C15H26F2O5 and a molecular weight of 324.36 g/mol. Its IUPAC name is 3-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-difluoro-3-pentoxypentanoic acid.
| Compound Name | 3-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-difluoro-3-pentoxypentanoic acid |
|---|---|
| PubChem CID | 69136595 |
| Molecular Formula | C15H26F2O5 |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 3-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-difluoro-3-pentoxypentanoic acid |
| SMILES | CCCCCOC(CC)(C1COC(C)(C)O1)C(F)(F)C(=O)O |
| InChI | InChI=1S/C15H26F2O5/c1-5-7-8-9-20-14(6-2,15(16,17)12(18)19)11-10-21-13(3,4)22-11/h11H,5-10H2,1-4H3,(H,18,19) |
| InChIKey | HJUZANXYKCJXFI-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|