C15H21NO — CID 69137002
(2R,4S)-1,7,7-trimethyl-2-pyridin-2-ylbicyclo[2.2.1]heptan-2-ol (PubChem CID 69137002) has the molecular formula C15H21NO and a molecular weight of 231.34 g/mol. Its IUPAC name is (2R,4S)-1,7,7-trimethyl-2-pyridin-2-ylbicyclo[2.2.1]heptan-2-ol.
| Compound Name | (2R,4S)-1,7,7-trimethyl-2-pyridin-2-ylbicyclo[2.2.1]heptan-2-ol |
|---|---|
| PubChem CID | 69137002 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | (2R,4S)-1,7,7-trimethyl-2-pyridin-2-ylbicyclo[2.2.1]heptan-2-ol |
| SMILES | CC1(C)[C@H]2CCC1(C)[C@@](O)(c1ccccn1)C2 |
| InChI | InChI=1S/C15H21NO/c1-13(2)11-7-8-14(13,3)15(17,10-11)12-6-4-5-9-16-12/h4-6,9,11,17H,7-8,10H2,1-3H3/t11-,14?,15-/m0/s1 |
| InChIKey | WUPYCTDTAKFJQT-NGKXAEKTSA-N |
| XLogP | 3.12 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |