C24H39ClN4O5 — CID 69137053
2,2-dimethylpropyl 6-[(3S,4R)-4-[(6-amino-5-chloro-2-methoxypyridine-3-carbonyl)amino]-3-methoxypiperidin-1-yl]hexanoate (PubChem CID 69137053) has the molecular formula C24H39ClN4O5 and a molecular weight of 499.05 g/mol. Its IUPAC name is 2,2-dimethylpropyl 6-[(3S,4R)-4-[(6-amino-5-chloro-2-methoxypyridine-3-carbonyl)amino]-3-methoxypiperidin-1-yl]hexanoate.
| Compound Name | 2,2-dimethylpropyl 6-[(3S,4R)-4-[(6-amino-5-chloro-2-methoxypyridine-3-carbonyl)amino]-3-methoxypiperidin-1-yl]hexanoate |
|---|---|
| PubChem CID | 69137053 |
| Molecular Formula | C24H39ClN4O5 |
| Molecular Weight | 499.05 g/mol |
| Exact Mass | 498.26 |
| IUPAC Name | 2,2-dimethylpropyl 6-[(3S,4R)-4-[(6-amino-5-chloro-2-methoxypyridine-3-carbonyl)amino]-3-methoxypiperidin-1-yl]hexanoate |
| SMILES | COc1nc(N)c(Cl)cc1C(=O)N[C@@H]1CCN(CCCCCC(=O)OCC(C)(C)C)C[C@@H]1OC |
| InChI | InChI=1S/C24H39ClN4O5/c1-24(2,3)15-34-20(30)9-7-6-8-11-29-12-10-18(19(14-29)32-4)27-22(31)16-13-17(25)21(26)28-23(16)33-5/h13,18-19H,6-12,14-15H2,1-5H3,(H2,26,28)(H,27,31)/t18-,19+/m1/s1 |
| InChIKey | FXMUPDXVMULESV-MOPGFXCFSA-N |
| XLogP | 3.29 |
| TPSA | 116.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.05 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|