About 2-(3-amino-4-methyl-3-propan-2-ylpentoxy)pyrazolo[1,5-a]pyridin-3-amine
2-(3-amino-4-methyl-3-propan-2-ylpentoxy)pyrazolo[1,5-a]pyridin-3-amine (PubChem CID 69137159) has the molecular formula C16H26N4O
and a molecular weight of 290.41 g/mol. Its IUPAC name is 2-(3-amino-4-methyl-3-propan-2-ylpentoxy)pyrazolo[1,5-a]pyridin-3-amine.
Molecular Properties
| Compound Name | 2-(3-amino-4-methyl-3-propan-2-ylpentoxy)pyrazolo[1,5-a]pyridin-3-amine |
| PubChem CID | 69137159 |
| Molecular Formula | C16H26N4O |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.21 |
| IUPAC Name | 2-(3-amino-4-methyl-3-propan-2-ylpentoxy)pyrazolo[1,5-a]pyridin-3-amine |
| SMILES | CC(C)C(N)(CCOc1nn2ccccc2c1N)C(C)C |
| InChI | InChI=1S/C16H26N4O/c1-11(2)16(18,12(3)4)8-10-21-15-14(17)13-7-5-6-9-20(13)19-15/h5-7,9,11-12H,8,10,17-18H2,1-4H3 |
| InChIKey | JTHDXOSWNCXPJN-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 78.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(3-amino-4-methyl-3-propan-2-ylpentoxy)pyrazolo[1,5-a]pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-amino-4-methyl-3-propan-2-ylpentoxy)pyrazolo[1,5-a]pyridin-3-amine?
The IUPAC name of 2-(3-amino-4-methyl-3-propan-2-ylpentoxy)pyrazolo[1,5-a]pyridin-3-amine (CID 69137159) is 2-(3-amino-4-methyl-3-propan-2-ylpentoxy)pyrazolo[1,5-a]pyridin-3-amine.
What is the SMILES notation for 2-(3-amino-4-methyl-3-propan-2-ylpentoxy)pyrazolo[1,5-a]pyridin-3-amine?
The canonical SMILES for 2-(3-amino-4-methyl-3-propan-2-ylpentoxy)pyrazolo[1,5-a]pyridin-3-amine is CC(C)C(N)(CCOc1nn2ccccc2c1N)C(C)C.
What is the InChIKey of 2-(3-amino-4-methyl-3-propan-2-ylpentoxy)pyrazolo[1,5-a]pyridin-3-amine?
The InChIKey is JTHDXOSWNCXPJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N4O/c1-11(2)16(18,12(3)4)8-10-21-15-14(17)13-7-5-6-9-20(13)19-15/h5-7,9,11-12H,8,10,17-18H2,1-4H3.
What are the key properties of 2-(3-amino-4-methyl-3-propan-2-ylpentoxy)pyrazolo[1,5-a]pyridin-3-amine?
2-(3-amino-4-methyl-3-propan-2-ylpentoxy)pyrazolo[1,5-a]pyridin-3-amine has a molecular weight of 290.41 g/mol, XLogP of 2.69, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-amino-4-methyl-3-propan-2-ylpentoxy)pyrazolo[1,5-a]pyridin-3-amine is sourced from PubChem (CID 69137159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).