About 2-phenyl-1,3-oxazolidine-5-carboxamide
2-phenyl-1,3-oxazolidine-5-carboxamide (PubChem CID 69137388) has the molecular formula C10H12N2O2
and a molecular weight of 192.22 g/mol. Its IUPAC name is 2-phenyl-1,3-oxazolidine-5-carboxamide.
Molecular Properties
| Compound Name | 2-phenyl-1,3-oxazolidine-5-carboxamide |
| PubChem CID | 69137388 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | 2-phenyl-1,3-oxazolidine-5-carboxamide |
| SMILES | NC(=O)C1CNC(c2ccccc2)O1 |
| InChI | InChI=1S/C10H12N2O2/c11-9(13)8-6-12-10(14-8)7-4-2-1-3-5-7/h1-5,8,10,12H,6H2,(H2,11,13) |
| InChIKey | DYWACSMWSWXSOB-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-phenyl-1,3-oxazolidine-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-1,3-oxazolidine-5-carboxamide?
The IUPAC name of 2-phenyl-1,3-oxazolidine-5-carboxamide (CID 69137388) is 2-phenyl-1,3-oxazolidine-5-carboxamide.
What is the SMILES notation for 2-phenyl-1,3-oxazolidine-5-carboxamide?
The canonical SMILES for 2-phenyl-1,3-oxazolidine-5-carboxamide is NC(=O)C1CNC(c2ccccc2)O1.
What is the InChIKey of 2-phenyl-1,3-oxazolidine-5-carboxamide?
The InChIKey is DYWACSMWSWXSOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O2/c11-9(13)8-6-12-10(14-8)7-4-2-1-3-5-7/h1-5,8,10,12H,6H2,(H2,11,13).
What are the key properties of 2-phenyl-1,3-oxazolidine-5-carboxamide?
2-phenyl-1,3-oxazolidine-5-carboxamide has a molecular weight of 192.22 g/mol, XLogP of 0.16, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-1,3-oxazolidine-5-carboxamide is sourced from PubChem (CID 69137388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).