About 3-[(E)-2-ethylpent-2-enyl]-1,2-dihydroimidazole
3-[(E)-2-ethylpent-2-enyl]-1,2-dihydroimidazole (PubChem CID 69137473) has the molecular formula C10H18N2
and a molecular weight of 166.27 g/mol. Its IUPAC name is 3-[(E)-2-ethylpent-2-enyl]-1,2-dihydroimidazole.
Molecular Properties
| Compound Name | 3-[(E)-2-ethylpent-2-enyl]-1,2-dihydroimidazole |
| PubChem CID | 69137473 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | 3-[(E)-2-ethylpent-2-enyl]-1,2-dihydroimidazole |
| SMILES | CC/C=C(\CC)CN1C=CNC1 |
| InChI | InChI=1S/C10H18N2/c1-3-5-10(4-2)8-12-7-6-11-9-12/h5-7,11H,3-4,8-9H2,1-2H3/b10-5+ |
| InChIKey | SBGYTEAJNDVBEO-BJMVGYQFSA-N |
| XLogP | 2.07 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(E)-2-ethylpent-2-enyl]-1,2-dihydroimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(E)-2-ethylpent-2-enyl]-1,2-dihydroimidazole?
The IUPAC name of 3-[(E)-2-ethylpent-2-enyl]-1,2-dihydroimidazole (CID 69137473) is 3-[(E)-2-ethylpent-2-enyl]-1,2-dihydroimidazole.
What is the SMILES notation for 3-[(E)-2-ethylpent-2-enyl]-1,2-dihydroimidazole?
The canonical SMILES for 3-[(E)-2-ethylpent-2-enyl]-1,2-dihydroimidazole is CC/C=C(\CC)CN1C=CNC1.
What is the InChIKey of 3-[(E)-2-ethylpent-2-enyl]-1,2-dihydroimidazole?
The InChIKey is SBGYTEAJNDVBEO-BJMVGYQFSA-N. The full InChI is InChI=1S/C10H18N2/c1-3-5-10(4-2)8-12-7-6-11-9-12/h5-7,11H,3-4,8-9H2,1-2H3/b10-5+.
What are the key properties of 3-[(E)-2-ethylpent-2-enyl]-1,2-dihydroimidazole?
3-[(E)-2-ethylpent-2-enyl]-1,2-dihydroimidazole has a molecular weight of 166.27 g/mol, XLogP of 2.07, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(E)-2-ethylpent-2-enyl]-1,2-dihydroimidazole is sourced from PubChem (CID 69137473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).