C22H17N5O3 — CID 69138025
1-[4-benzoyl-1-(pyridin-2-ylmethyl)pyrrol-2-yl]-3-hydroxy-3-(1H-1,2,4-triazol-5-yl)prop-2-en-1-one (PubChem CID 69138025) has the molecular formula C22H17N5O3 and a molecular weight of 399.41 g/mol. Its IUPAC name is 1-[4-benzoyl-1-(pyridin-2-ylmethyl)pyrrol-2-yl]-3-hydroxy-3-(1H-1,2,4-triazol-5-yl)prop-2-en-1-one.
| Compound Name | 1-[4-benzoyl-1-(pyridin-2-ylmethyl)pyrrol-2-yl]-3-hydroxy-3-(1H-1,2,4-triazol-5-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 69138025 |
| Molecular Formula | C22H17N5O3 |
| Molecular Weight | 399.41 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 1-[4-benzoyl-1-(pyridin-2-ylmethyl)pyrrol-2-yl]-3-hydroxy-3-(1H-1,2,4-triazol-5-yl)prop-2-en-1-one |
| SMILES | O=C(c1ccccc1)c1cc(C(=O)C=C(O)c2ncn[nH]2)n(Cc2ccccn2)c1 |
| InChI | InChI=1S/C22H17N5O3/c28-19(11-20(29)22-24-14-25-26-22)18-10-16(21(30)15-6-2-1-3-7-15)12-27(18)13-17-8-4-5-9-23-17/h1-12,14,29H,13H2,(H,24,25,26) |
| InChIKey | MEADCXCKHHXOKL-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.41 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|