C24H29FN4O2 — CID 69138043
3-[3-[1-(3-fluorophenyl)nonan-5-yl]-1H-pyrrol-2-yl]-1-(1H-1,2,4-triazol-5-yl)propane-1,2-dione (PubChem CID 69138043) has the molecular formula C24H29FN4O2 and a molecular weight of 424.52 g/mol. Its IUPAC name is 3-[3-[1-(3-fluorophenyl)nonan-5-yl]-1H-pyrrol-2-yl]-1-(1H-1,2,4-triazol-5-yl)propane-1,2-dione.
| Compound Name | 3-[3-[1-(3-fluorophenyl)nonan-5-yl]-1H-pyrrol-2-yl]-1-(1H-1,2,4-triazol-5-yl)propane-1,2-dione |
|---|---|
| PubChem CID | 69138043 |
| Molecular Formula | C24H29FN4O2 |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.23 |
| IUPAC Name | 3-[3-[1-(3-fluorophenyl)nonan-5-yl]-1H-pyrrol-2-yl]-1-(1H-1,2,4-triazol-5-yl)propane-1,2-dione |
| SMILES | CCCCC(CCCCc1cccc(F)c1)c1cc[nH]c1CC(=O)C(=O)c1ncn[nH]1 |
| InChI | InChI=1S/C24H29FN4O2/c1-2-3-9-18(10-5-4-7-17-8-6-11-19(25)14-17)20-12-13-26-21(20)15-22(30)23(31)24-27-16-28-29-24/h6,8,11-14,16,18,26H,2-5,7,9-10,15H2,1H3,(H,27,28,29) |
| InChIKey | DDNWLBOOXLITFX-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|