C16H10F3N3O4 — CID 69138101
1-(1H-1,2,4-triazol-5-yl)-3-[3-[3-(trifluoromethyl)phenoxy]furan-2-yl]propane-1,2-dione (PubChem CID 69138101) has the molecular formula C16H10F3N3O4 and a molecular weight of 365.27 g/mol. Its IUPAC name is 1-(1H-1,2,4-triazol-5-yl)-3-[3-[3-(trifluoromethyl)phenoxy]furan-2-yl]propane-1,2-dione.
| Compound Name | 1-(1H-1,2,4-triazol-5-yl)-3-[3-[3-(trifluoromethyl)phenoxy]furan-2-yl]propane-1,2-dione |
|---|---|
| PubChem CID | 69138101 |
| Molecular Formula | C16H10F3N3O4 |
| Molecular Weight | 365.27 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | 1-(1H-1,2,4-triazol-5-yl)-3-[3-[3-(trifluoromethyl)phenoxy]furan-2-yl]propane-1,2-dione |
| SMILES | O=C(Cc1occc1Oc1cccc(C(F)(F)F)c1)C(=O)c1ncn[nH]1 |
| InChI | InChI=1S/C16H10F3N3O4/c17-16(18,19)9-2-1-3-10(6-9)26-12-4-5-25-13(12)7-11(23)14(24)15-20-8-21-22-15/h1-6,8H,7H2,(H,20,21,22) |
| InChIKey | NYYCGGHKFSNKTL-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 98.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.27 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|