C16H13FN4O2 — CID 69138122
3-[1-[(2-fluorophenyl)methyl]pyrrol-2-yl]-1-(1H-1,2,4-triazol-5-yl)propane-1,2-dione (PubChem CID 69138122) has the molecular formula C16H13FN4O2 and a molecular weight of 312.30 g/mol. Its IUPAC name is 3-[1-[(2-fluorophenyl)methyl]pyrrol-2-yl]-1-(1H-1,2,4-triazol-5-yl)propane-1,2-dione.
| Compound Name | 3-[1-[(2-fluorophenyl)methyl]pyrrol-2-yl]-1-(1H-1,2,4-triazol-5-yl)propane-1,2-dione |
|---|---|
| PubChem CID | 69138122 |
| Molecular Formula | C16H13FN4O2 |
| Molecular Weight | 312.30 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 3-[1-[(2-fluorophenyl)methyl]pyrrol-2-yl]-1-(1H-1,2,4-triazol-5-yl)propane-1,2-dione |
| SMILES | O=C(Cc1cccn1Cc1ccccc1F)C(=O)c1ncn[nH]1 |
| InChI | InChI=1S/C16H13FN4O2/c17-13-6-2-1-4-11(13)9-21-7-3-5-12(21)8-14(22)15(23)16-18-10-19-20-16/h1-7,10H,8-9H2,(H,18,19,20) |
| InChIKey | HNJZCVIERAMWHY-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.30 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|