C15H11N3O5S — CID 69138313
3-[4-(benzenesulfonyl)furan-2-yl]-1-(1H-1,2,4-triazol-5-yl)propane-1,2-dione (PubChem CID 69138313) has the molecular formula C15H11N3O5S and a molecular weight of 345.34 g/mol. Its IUPAC name is 3-[4-(benzenesulfonyl)furan-2-yl]-1-(1H-1,2,4-triazol-5-yl)propane-1,2-dione.
| Compound Name | 3-[4-(benzenesulfonyl)furan-2-yl]-1-(1H-1,2,4-triazol-5-yl)propane-1,2-dione |
|---|---|
| PubChem CID | 69138313 |
| Molecular Formula | C15H11N3O5S |
| Molecular Weight | 345.34 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | 3-[4-(benzenesulfonyl)furan-2-yl]-1-(1H-1,2,4-triazol-5-yl)propane-1,2-dione |
| SMILES | O=C(Cc1cc(S(=O)(=O)c2ccccc2)co1)C(=O)c1ncn[nH]1 |
| InChI | InChI=1S/C15H11N3O5S/c19-13(14(20)15-16-9-17-18-15)7-10-6-12(8-23-10)24(21,22)11-4-2-1-3-5-11/h1-6,8-9H,7H2,(H,16,17,18) |
| InChIKey | DBSRLYFUCPBXGX-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 122.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.34 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|