C15H11FN4O4S — CID 69138317
3-[5-(4-fluorophenyl)sulfonyl-1H-pyrrol-3-yl]-1-(1H-1,2,4-triazol-5-yl)propane-1,2-dione (PubChem CID 69138317) has the molecular formula C15H11FN4O4S and a molecular weight of 362.34 g/mol. Its IUPAC name is 3-[5-(4-fluorophenyl)sulfonyl-1H-pyrrol-3-yl]-1-(1H-1,2,4-triazol-5-yl)propane-1,2-dione.
| Compound Name | 3-[5-(4-fluorophenyl)sulfonyl-1H-pyrrol-3-yl]-1-(1H-1,2,4-triazol-5-yl)propane-1,2-dione |
|---|---|
| PubChem CID | 69138317 |
| Molecular Formula | C15H11FN4O4S |
| Molecular Weight | 362.34 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | 3-[5-(4-fluorophenyl)sulfonyl-1H-pyrrol-3-yl]-1-(1H-1,2,4-triazol-5-yl)propane-1,2-dione |
| SMILES | O=C(Cc1c[nH]c(S(=O)(=O)c2ccc(F)cc2)c1)C(=O)c1ncn[nH]1 |
| InChI | InChI=1S/C15H11FN4O4S/c16-10-1-3-11(4-2-10)25(23,24)13-6-9(7-17-13)5-12(21)14(22)15-18-8-19-20-15/h1-4,6-8,17H,5H2,(H,18,19,20) |
| InChIKey | ZGPNVLPFSORBRU-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 125.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.34 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|