About 3-[5-[(2-fluorophenyl)methyl]-1H-pyrrol-2-yl]-1-(2H-tetrazol-5-yl)propane-1,2-dione
3-[5-[(2-fluorophenyl)methyl]-1H-pyrrol-2-yl]-1-(2H-tetrazol-5-yl)propane-1,2-dione (PubChem CID 69138366) has the molecular formula C15H12FN5O2
and a molecular weight of 313.29 g/mol. Its IUPAC name is 3-[5-[(2-fluorophenyl)methyl]-1H-pyrrol-2-yl]-1-(2H-tetrazol-5-yl)propane-1,2-dione.
Molecular Properties
| Compound Name | 3-[5-[(2-fluorophenyl)methyl]-1H-pyrrol-2-yl]-1-(2H-tetrazol-5-yl)propane-1,2-dione |
| PubChem CID | 69138366 |
| Molecular Formula | C15H12FN5O2 |
| Molecular Weight | 313.29 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 3-[5-[(2-fluorophenyl)methyl]-1H-pyrrol-2-yl]-1-(2H-tetrazol-5-yl)propane-1,2-dione |
| SMILES | O=C(Cc1ccc(Cc2ccccc2F)[nH]1)C(=O)c1nn[nH]n1 |
| InChI | InChI=1S/C15H12FN5O2/c16-12-4-2-1-3-9(12)7-10-5-6-11(17-10)8-13(22)14(23)15-18-20-21-19-15/h1-6,17H,7-8H2,(H,18,19,20,21) |
| InChIKey | ZAWCBYAFJKVCTC-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 104.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.29 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 3-[5-[(2-fluorophenyl)methyl]-1H-pyrrol-2-yl]-1-(2H-tetrazol-5-yl)propane-1,2-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-[(2-fluorophenyl)methyl]-1H-pyrrol-2-yl]-1-(2H-tetrazol-5-yl)propane-1,2-dione?
The IUPAC name of 3-[5-[(2-fluorophenyl)methyl]-1H-pyrrol-2-yl]-1-(2H-tetrazol-5-yl)propane-1,2-dione (CID 69138366) is 3-[5-[(2-fluorophenyl)methyl]-1H-pyrrol-2-yl]-1-(2H-tetrazol-5-yl)propane-1,2-dione.
What is the SMILES notation for 3-[5-[(2-fluorophenyl)methyl]-1H-pyrrol-2-yl]-1-(2H-tetrazol-5-yl)propane-1,2-dione?
The canonical SMILES for 3-[5-[(2-fluorophenyl)methyl]-1H-pyrrol-2-yl]-1-(2H-tetrazol-5-yl)propane-1,2-dione is O=C(Cc1ccc(Cc2ccccc2F)[nH]1)C(=O)c1nn[nH]n1.
What is the InChIKey of 3-[5-[(2-fluorophenyl)methyl]-1H-pyrrol-2-yl]-1-(2H-tetrazol-5-yl)propane-1,2-dione?
The InChIKey is ZAWCBYAFJKVCTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12FN5O2/c16-12-4-2-1-3-9(12)7-10-5-6-11(17-10)8-13(22)14(23)15-18-20-21-19-15/h1-6,17H,7-8H2,(H,18,19,20,21).
What are the key properties of 3-[5-[(2-fluorophenyl)methyl]-1H-pyrrol-2-yl]-1-(2H-tetrazol-5-yl)propane-1,2-dione?
3-[5-[(2-fluorophenyl)methyl]-1H-pyrrol-2-yl]-1-(2H-tetrazol-5-yl)propane-1,2-dione has a molecular weight of 313.29 g/mol, XLogP of 1.25, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-[(2-fluorophenyl)methyl]-1H-pyrrol-2-yl]-1-(2H-tetrazol-5-yl)propane-1,2-dione is sourced from PubChem (CID 69138366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).