C15H14N6O2 — CID 69138375
3-[1-[(4-aminophenyl)methyl]pyrazol-4-yl]-3-hydroxy-1-(1H-1,2,4-triazol-5-yl)prop-2-en-1-one (PubChem CID 69138375) has the molecular formula C15H14N6O2 and a molecular weight of 310.32 g/mol. Its IUPAC name is 3-[1-[(4-aminophenyl)methyl]pyrazol-4-yl]-3-hydroxy-1-(1H-1,2,4-triazol-5-yl)prop-2-en-1-one.
| Compound Name | 3-[1-[(4-aminophenyl)methyl]pyrazol-4-yl]-3-hydroxy-1-(1H-1,2,4-triazol-5-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 69138375 |
| Molecular Formula | C15H14N6O2 |
| Molecular Weight | 310.32 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 3-[1-[(4-aminophenyl)methyl]pyrazol-4-yl]-3-hydroxy-1-(1H-1,2,4-triazol-5-yl)prop-2-en-1-one |
| SMILES | Nc1ccc(Cn2cc(C(O)=CC(=O)c3ncn[nH]3)cn2)cc1 |
| InChI | InChI=1S/C15H14N6O2/c16-12-3-1-10(2-4-12)7-21-8-11(6-19-21)13(22)5-14(23)15-17-9-18-20-15/h1-6,8-9,22H,7,16H2,(H,17,18,20) |
| InChIKey | FBKCVTMDKAYGJR-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 122.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.32 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|