C16H10F3N3O3S — CID 69138376
3-hydroxy-1-(1H-1,2,4-triazol-5-yl)-3-[5-[2-(trifluoromethyl)phenyl]sulfanylfuran-3-yl]prop-2-en-1-one (PubChem CID 69138376) has the molecular formula C16H10F3N3O3S and a molecular weight of 381.34 g/mol. Its IUPAC name is 3-hydroxy-1-(1H-1,2,4-triazol-5-yl)-3-[5-[2-(trifluoromethyl)phenyl]sulfanylfuran-3-yl]prop-2-en-1-one.
| Compound Name | 3-hydroxy-1-(1H-1,2,4-triazol-5-yl)-3-[5-[2-(trifluoromethyl)phenyl]sulfanylfuran-3-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 69138376 |
| Molecular Formula | C16H10F3N3O3S |
| Molecular Weight | 381.34 g/mol |
| Exact Mass | 381.04 |
| IUPAC Name | 3-hydroxy-1-(1H-1,2,4-triazol-5-yl)-3-[5-[2-(trifluoromethyl)phenyl]sulfanylfuran-3-yl]prop-2-en-1-one |
| SMILES | O=C(C=C(O)c1coc(Sc2ccccc2C(F)(F)F)c1)c1ncn[nH]1 |
| InChI | InChI=1S/C16H10F3N3O3S/c17-16(18,19)10-3-1-2-4-13(10)26-14-5-9(7-25-14)11(23)6-12(24)15-20-8-21-22-15/h1-8,23H,(H,20,21,22) |
| InChIKey | ASXYVFQPTBTOTG-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 92.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.34 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|