C15H11ClN4O3 — CID 69138538
3-[5-chloro-2-(pyridin-4-ylmethyl)furan-3-yl]-3-hydroxy-1-(1H-1,2,4-triazol-5-yl)prop-2-en-1-one (PubChem CID 69138538) has the molecular formula C15H11ClN4O3 and a molecular weight of 330.73 g/mol. Its IUPAC name is 3-[5-chloro-2-(pyridin-4-ylmethyl)furan-3-yl]-3-hydroxy-1-(1H-1,2,4-triazol-5-yl)prop-2-en-1-one.
| Compound Name | 3-[5-chloro-2-(pyridin-4-ylmethyl)furan-3-yl]-3-hydroxy-1-(1H-1,2,4-triazol-5-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 69138538 |
| Molecular Formula | C15H11ClN4O3 |
| Molecular Weight | 330.73 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | 3-[5-chloro-2-(pyridin-4-ylmethyl)furan-3-yl]-3-hydroxy-1-(1H-1,2,4-triazol-5-yl)prop-2-en-1-one |
| SMILES | O=C(C=C(O)c1cc(Cl)oc1Cc1ccncc1)c1ncn[nH]1 |
| InChI | InChI=1S/C15H11ClN4O3/c16-14-6-10(11(21)7-12(22)15-18-8-19-20-15)13(23-14)5-9-1-3-17-4-2-9/h1-4,6-8,21H,5H2,(H,18,19,20) |
| InChIKey | FHCSJXMIDYFTCI-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 104.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.73 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|