C23H19N3O5S — CID 69139428
1-[3-(benzenesulfonyl)-5-(2-phenylethyl)furan-2-yl]-3-hydroxy-3-(1H-1,2,4-triazol-5-yl)prop-2-en-1-one (PubChem CID 69139428) has the molecular formula C23H19N3O5S and a molecular weight of 449.49 g/mol. Its IUPAC name is 1-[3-(benzenesulfonyl)-5-(2-phenylethyl)furan-2-yl]-3-hydroxy-3-(1H-1,2,4-triazol-5-yl)prop-2-en-1-one.
| Compound Name | 1-[3-(benzenesulfonyl)-5-(2-phenylethyl)furan-2-yl]-3-hydroxy-3-(1H-1,2,4-triazol-5-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 69139428 |
| Molecular Formula | C23H19N3O5S |
| Molecular Weight | 449.49 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | 1-[3-(benzenesulfonyl)-5-(2-phenylethyl)furan-2-yl]-3-hydroxy-3-(1H-1,2,4-triazol-5-yl)prop-2-en-1-one |
| SMILES | O=C(C=C(O)c1ncn[nH]1)c1oc(CCc2ccccc2)cc1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C23H19N3O5S/c27-19(14-20(28)23-24-15-25-26-23)22-21(32(29,30)18-9-5-2-6-10-18)13-17(31-22)12-11-16-7-3-1-4-8-16/h1-10,13-15,28H,11-12H2,(H,24,25,26) |
| InChIKey | KUZVOTWOLALTKX-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 126.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.49 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|