About (1S)-N'-(5-bromo-6-pyridin-4-yl-2-pyridinyl)-1-(2-fluorophenyl)propane-1,3-diamine
(1S)-N'-(5-bromo-6-pyridin-4-yl-2-pyridinyl)-1-(2-fluorophenyl)propane-1,3-diamine (PubChem CID 69140657) has the molecular formula C19H18BrFN4
and a molecular weight of 401.28 g/mol. Its IUPAC name is (1S)-N'-(5-bromo-6-pyridin-4-yl-2-pyridinyl)-1-(2-fluorophenyl)propane-1,3-diamine.
Molecular Properties
| Compound Name | (1S)-N'-(5-bromo-6-pyridin-4-yl-2-pyridinyl)-1-(2-fluorophenyl)propane-1,3-diamine |
| PubChem CID | 69140657 |
| Molecular Formula | C19H18BrFN4 |
| Molecular Weight | 401.28 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | (1S)-N'-(5-bromo-6-pyridin-4-yl-2-pyridinyl)-1-(2-fluorophenyl)propane-1,3-diamine |
| SMILES | N[C@@H](CCNc1ccc(Br)c(-c2ccncc2)n1)c1ccccc1F |
| InChI | InChI=1S/C19H18BrFN4/c20-15-5-6-18(25-19(15)13-7-10-23-11-8-13)24-12-9-17(22)14-3-1-2-4-16(14)21/h1-8,10-11,17H,9,12,22H2,(H,24,25)/t17-/m0/s1 |
| InChIKey | WGMUCFYTSCJCEE-KRWDZBQOSA-N |
| XLogP | 4.55 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.28 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1S)-N'-(5-bromo-6-pyridin-4-yl-2-pyridinyl)-1-(2-fluorophenyl)propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-N'-(5-bromo-6-pyridin-4-yl-2-pyridinyl)-1-(2-fluorophenyl)propane-1,3-diamine?
The IUPAC name of (1S)-N'-(5-bromo-6-pyridin-4-yl-2-pyridinyl)-1-(2-fluorophenyl)propane-1,3-diamine (CID 69140657) is (1S)-N'-(5-bromo-6-pyridin-4-yl-2-pyridinyl)-1-(2-fluorophenyl)propane-1,3-diamine.
What is the SMILES notation for (1S)-N'-(5-bromo-6-pyridin-4-yl-2-pyridinyl)-1-(2-fluorophenyl)propane-1,3-diamine?
The canonical SMILES for (1S)-N'-(5-bromo-6-pyridin-4-yl-2-pyridinyl)-1-(2-fluorophenyl)propane-1,3-diamine is N[C@@H](CCNc1ccc(Br)c(-c2ccncc2)n1)c1ccccc1F.
What is the InChIKey of (1S)-N'-(5-bromo-6-pyridin-4-yl-2-pyridinyl)-1-(2-fluorophenyl)propane-1,3-diamine?
The InChIKey is WGMUCFYTSCJCEE-KRWDZBQOSA-N. The full InChI is InChI=1S/C19H18BrFN4/c20-15-5-6-18(25-19(15)13-7-10-23-11-8-13)24-12-9-17(22)14-3-1-2-4-16(14)21/h1-8,10-11,17H,9,12,22H2,(H,24,25)/t17-/m0/s1.
What are the key properties of (1S)-N'-(5-bromo-6-pyridin-4-yl-2-pyridinyl)-1-(2-fluorophenyl)propane-1,3-diamine?
(1S)-N'-(5-bromo-6-pyridin-4-yl-2-pyridinyl)-1-(2-fluorophenyl)propane-1,3-diamine has a molecular weight of 401.28 g/mol, XLogP of 4.55, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-N'-(5-bromo-6-pyridin-4-yl-2-pyridinyl)-1-(2-fluorophenyl)propane-1,3-diamine is sourced from PubChem (CID 69140657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).