C15H10ClN3O5S — CID 69140917
3-(2-chlorofuran-3-yl)-3-hydroxy-1-(1H-1,2,4-triazol-5-yl)prop-2-en-1-one;7λ6-thiabicyclo[2.2.1]hepta-1,3,5-triene 7,7-dioxide (PubChem CID 69140917) has the molecular formula C15H10ClN3O5S and a molecular weight of 379.78 g/mol. Its IUPAC name is 3-(2-chlorofuran-3-yl)-3-hydroxy-1-(1H-1,2,4-triazol-5-yl)prop-2-en-1-one;7λ6-thiabicyclo[2.2.1]hepta-1,3,5-triene 7,7-dioxide.
| Compound Name | 3-(2-chlorofuran-3-yl)-3-hydroxy-1-(1H-1,2,4-triazol-5-yl)prop-2-en-1-one;7λ6-thiabicyclo[2.2.1]hepta-1,3,5-triene 7,7-dioxide |
|---|---|
| PubChem CID | 69140917 |
| Molecular Formula | C15H10ClN3O5S |
| Molecular Weight | 379.78 g/mol |
| Exact Mass | 379.00 |
| IUPAC Name | 3-(2-chlorofuran-3-yl)-3-hydroxy-1-(1H-1,2,4-triazol-5-yl)prop-2-en-1-one;7λ6-thiabicyclo[2.2.1]hepta-1,3,5-triene 7,7-dioxide |
| SMILES | O=C(C=C(O)c1ccoc1Cl)c1ncn[nH]1.O=S1(=O)C2=CC=C1C=C2 |
| InChI | InChI=1S/C9H6ClN3O3.C6H4O2S/c10-8-5(1-2-16-8)6(14)3-7(15)9-11-4-12-13-9;7-9(8)5-1-2-6(9)4-3-5/h1-4,14H,(H,11,12,13);1-4H |
| InChIKey | YLUICDVFKSZBGW-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 126.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.78 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|