C15H10ClN3O5S — CID 69140918
1-[4-(4-chlorophenyl)sulfonylfuran-2-yl]-3-hydroxy-3-(1H-1,2,4-triazol-5-yl)prop-2-en-1-one (PubChem CID 69140918) has the molecular formula C15H10ClN3O5S and a molecular weight of 379.78 g/mol. Its IUPAC name is 1-[4-(4-chlorophenyl)sulfonylfuran-2-yl]-3-hydroxy-3-(1H-1,2,4-triazol-5-yl)prop-2-en-1-one.
| Compound Name | 1-[4-(4-chlorophenyl)sulfonylfuran-2-yl]-3-hydroxy-3-(1H-1,2,4-triazol-5-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 69140918 |
| Molecular Formula | C15H10ClN3O5S |
| Molecular Weight | 379.78 g/mol |
| Exact Mass | 379.00 |
| IUPAC Name | 1-[4-(4-chlorophenyl)sulfonylfuran-2-yl]-3-hydroxy-3-(1H-1,2,4-triazol-5-yl)prop-2-en-1-one |
| SMILES | O=C(C=C(O)c1ncn[nH]1)c1cc(S(=O)(=O)c2ccc(Cl)cc2)co1 |
| InChI | InChI=1S/C15H10ClN3O5S/c16-9-1-3-10(4-2-9)25(22,23)11-5-14(24-7-11)12(20)6-13(21)15-17-8-18-19-15/h1-8,21H,(H,17,18,19) |
| InChIKey | QFRABALHJLBSKT-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 126.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.78 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|